C30H29F2N3O6 — CID 146567180
(2S)-2-[(4-amino-2,6-difluorobenzoyl)amino]-3-[8-[4-(ethoxymethyl)-2,6-dimethoxyphenyl]quinolin-5-yl]propanoic acid (PubChem CID 146567180) has the molecular formula C30H29F2N3O6 and a molecular weight of 565.57 g/mol. Its IUPAC name is (2S)-2-[(4-amino-2,6-difluorobenzoyl)amino]-3-[8-[4-(ethoxymethyl)-2,6-dimethoxyphenyl]quinolin-5-yl]propanoic acid.
| Compound Name | (2S)-2-[(4-amino-2,6-difluorobenzoyl)amino]-3-[8-[4-(ethoxymethyl)-2,6-dimethoxyphenyl]quinolin-5-yl]propanoic acid |
|---|---|
| PubChem CID | 146567180 |
| Molecular Formula | C30H29F2N3O6 |
| Molecular Weight | 565.57 g/mol |
| Exact Mass | 565.20 |
| IUPAC Name | (2S)-2-[(4-amino-2,6-difluorobenzoyl)amino]-3-[8-[4-(ethoxymethyl)-2,6-dimethoxyphenyl]quinolin-5-yl]propanoic acid |
| SMILES | CCOCc1cc(OC)c(-c2ccc(C[C@H](NC(=O)c3c(F)cc(N)cc3F)C(=O)O)c3cccnc23)c(OC)c1 |
| InChI | InChI=1S/C30H29F2N3O6/c1-4-41-15-16-10-24(39-2)26(25(11-16)40-3)20-8-7-17(19-6-5-9-34-28(19)20)12-23(30(37)38)35-29(36)27-21(31)13-18(33)14-22(27)32/h5-11,13-14,23H,4,12,15,33H2,1-3H3,(H,35,36)(H,37,38)/t23-/m0/s1 |
| InChIKey | YLAIYRZKCLOBJB-QHCPKHFHSA-N |
| XLogP | 4.74 |
| TPSA | 133.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.57 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|