C12H17NO2S2 — CID 14656751
1-(2,2,8-trimethyl-4H-[1,3]dioxino[4,5-c]pyridin-5-yl)ethane-1,2-dithiol (PubChem CID 14656751) has the molecular formula C12H17NO2S2 and a molecular weight of 271.41 g/mol. Its IUPAC name is 1-(2,2,8-trimethyl-4H-[1,3]dioxino[4,5-c]pyridin-5-yl)ethane-1,2-dithiol.
| Compound Name | 1-(2,2,8-trimethyl-4H-[1,3]dioxino[4,5-c]pyridin-5-yl)ethane-1,2-dithiol |
|---|---|
| PubChem CID | 14656751 |
| Molecular Formula | C12H17NO2S2 |
| Molecular Weight | 271.41 g/mol |
| Exact Mass | 271.07 |
| IUPAC Name | 1-(2,2,8-trimethyl-4H-[1,3]dioxino[4,5-c]pyridin-5-yl)ethane-1,2-dithiol |
| SMILES | Cc1ncc(C(S)CS)c2c1OC(C)(C)OC2 |
| InChI | InChI=1S/C12H17NO2S2/c1-7-11-9(5-14-12(2,3)15-11)8(4-13-7)10(17)6-16/h4,10,16-17H,5-6H2,1-3H3 |
| InChIKey | BSKFLDITTBBXRY-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 31.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.41 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|