About 3-ethynyl-1-hydroxypyrazolo[5,4-d][1,3]thiazole
3-ethynyl-1-hydroxypyrazolo[5,4-d][1,3]thiazole (PubChem CID 146568121) has the molecular formula C6H3N3OS
and a molecular weight of 165.18 g/mol. Its IUPAC name is 3-ethynyl-1-hydroxypyrazolo[5,4-d][1,3]thiazole.
Molecular Properties
| Compound Name | 3-ethynyl-1-hydroxypyrazolo[5,4-d][1,3]thiazole |
| PubChem CID | 146568121 |
| Molecular Formula | C6H3N3OS |
| Molecular Weight | 165.18 g/mol |
| Exact Mass | 165.00 |
| IUPAC Name | 3-ethynyl-1-hydroxypyrazolo[5,4-d][1,3]thiazole |
| SMILES | C#Cc1nn(O)c2ncsc12 |
| InChI | InChI=1S/C6H3N3OS/c1-2-4-5-6(7-3-11-5)9(10)8-4/h1,3,10H |
| InChIKey | LMDQUASSSQAGQJ-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.18 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-ethynyl-1-hydroxypyrazolo[5,4-d][1,3]thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethynyl-1-hydroxypyrazolo[5,4-d][1,3]thiazole?
The IUPAC name of 3-ethynyl-1-hydroxypyrazolo[5,4-d][1,3]thiazole (CID 146568121) is 3-ethynyl-1-hydroxypyrazolo[5,4-d][1,3]thiazole.
What is the SMILES notation for 3-ethynyl-1-hydroxypyrazolo[5,4-d][1,3]thiazole?
The canonical SMILES for 3-ethynyl-1-hydroxypyrazolo[5,4-d][1,3]thiazole is C#Cc1nn(O)c2ncsc12.
What is the InChIKey of 3-ethynyl-1-hydroxypyrazolo[5,4-d][1,3]thiazole?
The InChIKey is LMDQUASSSQAGQJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H3N3OS/c1-2-4-5-6(7-3-11-5)9(10)8-4/h1,3,10H.
What are the key properties of 3-ethynyl-1-hydroxypyrazolo[5,4-d][1,3]thiazole?
3-ethynyl-1-hydroxypyrazolo[5,4-d][1,3]thiazole has a molecular weight of 165.18 g/mol, XLogP of 0.71, 0 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethynyl-1-hydroxypyrazolo[5,4-d][1,3]thiazole is sourced from PubChem (CID 146568121), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).