About (Z)-1-(1,4-dimethylpyrrolidin-3-yl)-N-ethylpent-3-en-2-imine
(Z)-1-(1,4-dimethylpyrrolidin-3-yl)-N-ethylpent-3-en-2-imine (PubChem CID 146568242) has the molecular formula C13H24N2
and a molecular weight of 208.35 g/mol. Its IUPAC name is (Z)-1-(1,4-dimethylpyrrolidin-3-yl)-N-ethylpent-3-en-2-imine.
Molecular Properties
| Compound Name | (Z)-1-(1,4-dimethylpyrrolidin-3-yl)-N-ethylpent-3-en-2-imine |
| PubChem CID | 146568242 |
| Molecular Formula | C13H24N2 |
| Molecular Weight | 208.35 g/mol |
| Exact Mass | 208.19 |
| IUPAC Name | (Z)-1-(1,4-dimethylpyrrolidin-3-yl)-N-ethylpent-3-en-2-imine |
| SMILES | C/C=C\C(CC1CN(C)CC1C)=N/CC |
| InChI | InChI=1S/C13H24N2/c1-5-7-13(14-6-2)8-12-10-15(4)9-11(12)3/h5,7,11-12H,6,8-10H2,1-4H3/b7-5-,14-13+ |
| InChIKey | YVFAESGQJQLCIM-JEASJYNGSA-N |
| XLogP | 2.61 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.35 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (Z)-1-(1,4-dimethylpyrrolidin-3-yl)-N-ethylpent-3-en-2-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-1-(1,4-dimethylpyrrolidin-3-yl)-N-ethylpent-3-en-2-imine?
The IUPAC name of (Z)-1-(1,4-dimethylpyrrolidin-3-yl)-N-ethylpent-3-en-2-imine (CID 146568242) is (Z)-1-(1,4-dimethylpyrrolidin-3-yl)-N-ethylpent-3-en-2-imine.
What is the SMILES notation for (Z)-1-(1,4-dimethylpyrrolidin-3-yl)-N-ethylpent-3-en-2-imine?
The canonical SMILES for (Z)-1-(1,4-dimethylpyrrolidin-3-yl)-N-ethylpent-3-en-2-imine is C/C=C\C(CC1CN(C)CC1C)=N/CC.
What is the InChIKey of (Z)-1-(1,4-dimethylpyrrolidin-3-yl)-N-ethylpent-3-en-2-imine?
The InChIKey is YVFAESGQJQLCIM-JEASJYNGSA-N. The full InChI is InChI=1S/C13H24N2/c1-5-7-13(14-6-2)8-12-10-15(4)9-11(12)3/h5,7,11-12H,6,8-10H2,1-4H3/b7-5-,14-13+.
What are the key properties of (Z)-1-(1,4-dimethylpyrrolidin-3-yl)-N-ethylpent-3-en-2-imine?
(Z)-1-(1,4-dimethylpyrrolidin-3-yl)-N-ethylpent-3-en-2-imine has a molecular weight of 208.35 g/mol, XLogP of 2.61, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-1-(1,4-dimethylpyrrolidin-3-yl)-N-ethylpent-3-en-2-imine is sourced from PubChem (CID 146568242), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).