About (6S)-2,6-dimethyl-2-(3-methyl-3-prop-2-ynoxybutoxy)undecan-5-one
(6S)-2,6-dimethyl-2-(3-methyl-3-prop-2-ynoxybutoxy)undecan-5-one (PubChem CID 146568470) has the molecular formula C21H38O3
and a molecular weight of 338.53 g/mol. Its IUPAC name is (6S)-2,6-dimethyl-2-(3-methyl-3-prop-2-ynoxybutoxy)undecan-5-one.
Molecular Properties
| Compound Name | (6S)-2,6-dimethyl-2-(3-methyl-3-prop-2-ynoxybutoxy)undecan-5-one |
| PubChem CID | 146568470 |
| Molecular Formula | C21H38O3 |
| Molecular Weight | 338.53 g/mol |
| Exact Mass | 338.28 |
| IUPAC Name | (6S)-2,6-dimethyl-2-(3-methyl-3-prop-2-ynoxybutoxy)undecan-5-one |
| SMILES | C#CCOC(C)(C)CCOC(C)(C)CCC(=O)[C@@H](C)CCCCC |
| InChI | InChI=1S/C21H38O3/c1-8-10-11-12-18(3)19(22)13-14-20(4,5)24-17-15-21(6,7)23-16-9-2/h2,18H,8,10-17H2,1,3-7H3/t18-/m0/s1 |
| InChIKey | IPIDNFRIAGHNAS-SFHVURJKSA-N |
| XLogP | 5.17 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 338.53 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze (6S)-2,6-dimethyl-2-(3-methyl-3-prop-2-ynoxybutoxy)undecan-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6S)-2,6-dimethyl-2-(3-methyl-3-prop-2-ynoxybutoxy)undecan-5-one?
The IUPAC name of (6S)-2,6-dimethyl-2-(3-methyl-3-prop-2-ynoxybutoxy)undecan-5-one (CID 146568470) is (6S)-2,6-dimethyl-2-(3-methyl-3-prop-2-ynoxybutoxy)undecan-5-one.
What is the SMILES notation for (6S)-2,6-dimethyl-2-(3-methyl-3-prop-2-ynoxybutoxy)undecan-5-one?
The canonical SMILES for (6S)-2,6-dimethyl-2-(3-methyl-3-prop-2-ynoxybutoxy)undecan-5-one is C#CCOC(C)(C)CCOC(C)(C)CCC(=O)[C@@H](C)CCCCC.
What is the InChIKey of (6S)-2,6-dimethyl-2-(3-methyl-3-prop-2-ynoxybutoxy)undecan-5-one?
The InChIKey is IPIDNFRIAGHNAS-SFHVURJKSA-N. The full InChI is InChI=1S/C21H38O3/c1-8-10-11-12-18(3)19(22)13-14-20(4,5)24-17-15-21(6,7)23-16-9-2/h2,18H,8,10-17H2,1,3-7H3/t18-/m0/s1.
What are the key properties of (6S)-2,6-dimethyl-2-(3-methyl-3-prop-2-ynoxybutoxy)undecan-5-one?
(6S)-2,6-dimethyl-2-(3-methyl-3-prop-2-ynoxybutoxy)undecan-5-one has a molecular weight of 338.53 g/mol, XLogP of 5.17, 14 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (6S)-2,6-dimethyl-2-(3-methyl-3-prop-2-ynoxybutoxy)undecan-5-one is sourced from PubChem (CID 146568470), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).