C25H38N2O5S — CID 146568723
benzyl (Z)-8-[[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-methylsulfanylbutanoyl]amino]oct-5-enoate (PubChem CID 146568723) has the molecular formula C25H38N2O5S and a molecular weight of 478.66 g/mol. Its IUPAC name is benzyl (Z)-8-[[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-methylsulfanylbutanoyl]amino]oct-5-enoate.
| Compound Name | benzyl (Z)-8-[[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-methylsulfanylbutanoyl]amino]oct-5-enoate |
|---|---|
| PubChem CID | 146568723 |
| Molecular Formula | C25H38N2O5S |
| Molecular Weight | 478.66 g/mol |
| Exact Mass | 478.25 |
| IUPAC Name | benzyl (Z)-8-[[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-methylsulfanylbutanoyl]amino]oct-5-enoate |
| SMILES | CSCC[C@H](NC(=O)OC(C)(C)C)C(=O)NCC/C=C\CCCC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C25H38N2O5S/c1-25(2,3)32-24(30)27-21(16-18-33-4)23(29)26-17-12-7-5-6-11-15-22(28)31-19-20-13-9-8-10-14-20/h5,7-10,13-14,21H,6,11-12,15-19H2,1-4H3,(H,26,29)(H,27,30)/b7-5-/t21-/m0/s1 |
| InChIKey | YRPIHANPRNXIIY-JKTFDMFLSA-N |
| XLogP | 4.61 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.66 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|