About [1,3]oxazolo[5,4-b]pyridin-6-ol
[1,3]oxazolo[5,4-b]pyridin-6-ol (PubChem CID 146568826) has the molecular formula C6H4N2O2
and a molecular weight of 136.11 g/mol. Its IUPAC name is [1,3]oxazolo[5,4-b]pyridin-6-ol.
Molecular Properties
| Compound Name | [1,3]oxazolo[5,4-b]pyridin-6-ol |
| PubChem CID | 146568826 |
| Molecular Formula | C6H4N2O2 |
| Molecular Weight | 136.11 g/mol |
| Exact Mass | 136.03 |
| IUPAC Name | [1,3]oxazolo[5,4-b]pyridin-6-ol |
| SMILES | Oc1cnc2ocnc2c1 |
| InChI | InChI=1S/C6H4N2O2/c9-4-1-5-6(7-2-4)10-3-8-5/h1-3,9H |
| InChIKey | LIUVTCPTWBYTMK-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 59.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 136.11 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [1,3]oxazolo[5,4-b]pyridin-6-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1,3]oxazolo[5,4-b]pyridin-6-ol?
The IUPAC name of [1,3]oxazolo[5,4-b]pyridin-6-ol (CID 146568826) is [1,3]oxazolo[5,4-b]pyridin-6-ol.
What is the SMILES notation for [1,3]oxazolo[5,4-b]pyridin-6-ol?
The canonical SMILES for [1,3]oxazolo[5,4-b]pyridin-6-ol is Oc1cnc2ocnc2c1.
What is the InChIKey of [1,3]oxazolo[5,4-b]pyridin-6-ol?
The InChIKey is LIUVTCPTWBYTMK-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4N2O2/c9-4-1-5-6(7-2-4)10-3-8-5/h1-3,9H.
What are the key properties of [1,3]oxazolo[5,4-b]pyridin-6-ol?
[1,3]oxazolo[5,4-b]pyridin-6-ol has a molecular weight of 136.11 g/mol, XLogP of 0.93, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [1,3]oxazolo[5,4-b]pyridin-6-ol is sourced from PubChem (CID 146568826), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).