C29H39N5 — CID 146569010
N-(2-cyclooctylethyl)-6-[(3Z,5Z)-4-(ethenyliminomethyl)-3-[(Z)-prop-1-enyl]hepta-1,3,5-trien-2-yl]imidazo[1,2-a]pyrazin-8-amine (PubChem CID 146569010) has the molecular formula C29H39N5 and a molecular weight of 457.67 g/mol. Its IUPAC name is N-(2-cyclooctylethyl)-6-[(3Z,5Z)-4-(ethenyliminomethyl)-3-[(Z)-prop-1-enyl]hepta-1,3,5-trien-2-yl]imidazo[1,2-a]pyrazin-8-amine.
| Compound Name | N-(2-cyclooctylethyl)-6-[(3Z,5Z)-4-(ethenyliminomethyl)-3-[(Z)-prop-1-enyl]hepta-1,3,5-trien-2-yl]imidazo[1,2-a]pyrazin-8-amine |
|---|---|
| PubChem CID | 146569010 |
| Molecular Formula | C29H39N5 |
| Molecular Weight | 457.67 g/mol |
| Exact Mass | 457.32 |
| IUPAC Name | N-(2-cyclooctylethyl)-6-[(3Z,5Z)-4-(ethenyliminomethyl)-3-[(Z)-prop-1-enyl]hepta-1,3,5-trien-2-yl]imidazo[1,2-a]pyrazin-8-amine |
| SMILES | C=C/N=C\C(\C=C/C)=C(\C=C/C)C(=C)c1cn2ccnc2c(NCCC2CCCCCCC2)n1 |
| InChI | InChI=1S/C29H39N5/c1-5-13-25(21-30-7-3)26(14-6-2)23(4)27-22-34-20-19-32-29(34)28(33-27)31-18-17-24-15-11-9-8-10-12-16-24/h5-7,13-14,19-22,24H,3-4,8-12,15-18H2,1-2H3,(H,31,33)/b13-5-,14-6-,26-25-,30-21+ |
| InChIKey | SQOMNWFGDCAMPP-GRLHZJSRSA-N |
| XLogP | 7.57 |
| TPSA | 54.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.67 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|