About 6-[[3,5-bis(trifluoromethyl)phenyl]carbamoyl]pyridine-2-carboxylic acid
6-[[3,5-bis(trifluoromethyl)phenyl]carbamoyl]pyridine-2-carboxylic acid (PubChem CID 146569016) has the molecular formula C15H8F6N2O3
and a molecular weight of 378.23 g/mol. Its IUPAC name is 6-[[3,5-bis(trifluoromethyl)phenyl]carbamoyl]pyridine-2-carboxylic acid.
Molecular Properties
| Compound Name | 6-[[3,5-bis(trifluoromethyl)phenyl]carbamoyl]pyridine-2-carboxylic acid |
| PubChem CID | 146569016 |
| Molecular Formula | C15H8F6N2O3 |
| Molecular Weight | 378.23 g/mol |
| Exact Mass | 378.04 |
| IUPAC Name | 6-[[3,5-bis(trifluoromethyl)phenyl]carbamoyl]pyridine-2-carboxylic acid |
| SMILES | O=C(O)c1cccc(C(=O)Nc2cc(C(F)(F)F)cc(C(F)(F)F)c2)n1 |
| InChI | InChI=1S/C15H8F6N2O3/c16-14(17,18)7-4-8(15(19,20)21)6-9(5-7)22-12(24)10-2-1-3-11(23-10)13(25)26/h1-6H,(H,22,24)(H,25,26) |
| InChIKey | UBBDDANPBWVPQN-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 378.23 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-[[3,5-bis(trifluoromethyl)phenyl]carbamoyl]pyridine-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[[3,5-bis(trifluoromethyl)phenyl]carbamoyl]pyridine-2-carboxylic acid?
The IUPAC name of 6-[[3,5-bis(trifluoromethyl)phenyl]carbamoyl]pyridine-2-carboxylic acid (CID 146569016) is 6-[[3,5-bis(trifluoromethyl)phenyl]carbamoyl]pyridine-2-carboxylic acid.
What is the SMILES notation for 6-[[3,5-bis(trifluoromethyl)phenyl]carbamoyl]pyridine-2-carboxylic acid?
The canonical SMILES for 6-[[3,5-bis(trifluoromethyl)phenyl]carbamoyl]pyridine-2-carboxylic acid is O=C(O)c1cccc(C(=O)Nc2cc(C(F)(F)F)cc(C(F)(F)F)c2)n1.
What is the InChIKey of 6-[[3,5-bis(trifluoromethyl)phenyl]carbamoyl]pyridine-2-carboxylic acid?
The InChIKey is UBBDDANPBWVPQN-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H8F6N2O3/c16-14(17,18)7-4-8(15(19,20)21)6-9(5-7)22-12(24)10-2-1-3-11(23-10)13(25)26/h1-6H,(H,22,24)(H,25,26).
What are the key properties of 6-[[3,5-bis(trifluoromethyl)phenyl]carbamoyl]pyridine-2-carboxylic acid?
6-[[3,5-bis(trifluoromethyl)phenyl]carbamoyl]pyridine-2-carboxylic acid has a molecular weight of 378.23 g/mol, XLogP of 4.07, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[[3,5-bis(trifluoromethyl)phenyl]carbamoyl]pyridine-2-carboxylic acid is sourced from PubChem (CID 146569016), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).