C36H57N7OS — CID 146569345
(8Z)-8-[[2-[bis(2-ethylhexyl)amino]-4-tert-butyl-1,3-thiazol-5-yl]imino]-2-(2,2-dimethylpropyl)-7-methyl-5-oxo-[1,2,4]triazolo[1,5-a]pyridine-6-carbonitrile (PubChem CID 146569345) has the molecular formula C36H57N7OS and a molecular weight of 635.97 g/mol. Its IUPAC name is (8Z)-8-[[2-[bis(2-ethylhexyl)amino]-4-tert-butyl-1,3-thiazol-5-yl]imino]-2-(2,2-dimethylpropyl)-7-methyl-5-oxo-[1,2,4]triazolo[1,5-a]pyridine-6-carbonitrile.
| Compound Name | (8Z)-8-[[2-[bis(2-ethylhexyl)amino]-4-tert-butyl-1,3-thiazol-5-yl]imino]-2-(2,2-dimethylpropyl)-7-methyl-5-oxo-[1,2,4]triazolo[1,5-a]pyridine-6-carbonitrile |
|---|---|
| PubChem CID | 146569345 |
| Molecular Formula | C36H57N7OS |
| Molecular Weight | 635.97 g/mol |
| Exact Mass | 635.43 |
| IUPAC Name | (8Z)-8-[[2-[bis(2-ethylhexyl)amino]-4-tert-butyl-1,3-thiazol-5-yl]imino]-2-(2,2-dimethylpropyl)-7-methyl-5-oxo-[1,2,4]triazolo[1,5-a]pyridine-6-carbonitrile |
| SMILES | CCCCC(CC)CN(CC(CC)CCCC)c1nc(C(C)(C)C)c(/N=C2/C(C)=C(C#N)C(=O)n3nc(CC(C)(C)C)nc32)s1 |
| InChI | InChI=1S/C36H57N7OS/c1-12-16-18-25(14-3)22-42(23-26(15-4)19-17-13-2)34-40-30(36(9,10)11)32(45-34)39-29-24(5)27(21-37)33(44)43-31(29)38-28(41-43)20-35(6,7)8/h25-26H,12-20,22-23H2,1-11H3/b39-29- |
| InChIKey | CIMJMRNJCWEMDC-RGINJTCGSA-N |
| XLogP | 9.47 |
| TPSA | 100.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.97 |
| LogP ≤ 5 | 9.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|