About 6-fluoro-1,3-di(propan-2-yl)pyridin-2-one
6-fluoro-1,3-di(propan-2-yl)pyridin-2-one (PubChem CID 146569437) has the molecular formula C11H16FNO
and a molecular weight of 197.25 g/mol. Its IUPAC name is 6-fluoro-1,3-di(propan-2-yl)pyridin-2-one.
Molecular Properties
| Compound Name | 6-fluoro-1,3-di(propan-2-yl)pyridin-2-one |
| PubChem CID | 146569437 |
| Molecular Formula | C11H16FNO |
| Molecular Weight | 197.25 g/mol |
| Exact Mass | 197.12 |
| IUPAC Name | 6-fluoro-1,3-di(propan-2-yl)pyridin-2-one |
| SMILES | CC(C)c1ccc(F)n(C(C)C)c1=O |
| InChI | InChI=1S/C11H16FNO/c1-7(2)9-5-6-10(12)13(8(3)4)11(9)14/h5-8H,1-4H3 |
| InChIKey | SMAAMGGTLMHCQY-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.25 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 6-fluoro-1,3-di(propan-2-yl)pyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-fluoro-1,3-di(propan-2-yl)pyridin-2-one?
The IUPAC name of 6-fluoro-1,3-di(propan-2-yl)pyridin-2-one (CID 146569437) is 6-fluoro-1,3-di(propan-2-yl)pyridin-2-one.
What is the SMILES notation for 6-fluoro-1,3-di(propan-2-yl)pyridin-2-one?
The canonical SMILES for 6-fluoro-1,3-di(propan-2-yl)pyridin-2-one is CC(C)c1ccc(F)n(C(C)C)c1=O.
What is the InChIKey of 6-fluoro-1,3-di(propan-2-yl)pyridin-2-one?
The InChIKey is SMAAMGGTLMHCQY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16FNO/c1-7(2)9-5-6-10(12)13(8(3)4)11(9)14/h5-8H,1-4H3.
What are the key properties of 6-fluoro-1,3-di(propan-2-yl)pyridin-2-one?
6-fluoro-1,3-di(propan-2-yl)pyridin-2-one has a molecular weight of 197.25 g/mol, XLogP of 2.69, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-fluoro-1,3-di(propan-2-yl)pyridin-2-one is sourced from PubChem (CID 146569437), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).