About 3-cyclopropyloxy-1-(2,2-difluoroethyl)pyrazol-4-amine
3-cyclopropyloxy-1-(2,2-difluoroethyl)pyrazol-4-amine (PubChem CID 146569693) has the molecular formula C8H11F2N3O
and a molecular weight of 203.19 g/mol. Its IUPAC name is 3-cyclopropyloxy-1-(2,2-difluoroethyl)pyrazol-4-amine.
Molecular Properties
| Compound Name | 3-cyclopropyloxy-1-(2,2-difluoroethyl)pyrazol-4-amine |
| PubChem CID | 146569693 |
| Molecular Formula | C8H11F2N3O |
| Molecular Weight | 203.19 g/mol |
| Exact Mass | 203.09 |
| IUPAC Name | 3-cyclopropyloxy-1-(2,2-difluoroethyl)pyrazol-4-amine |
| SMILES | Nc1cn(CC(F)F)nc1OC1CC1 |
| InChI | InChI=1S/C8H11F2N3O/c9-7(10)4-13-3-6(11)8(12-13)14-5-1-2-5/h3,5,7H,1-2,4,11H2 |
| InChIKey | GVPRNKDJIBKWNQ-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 53.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.19 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-cyclopropyloxy-1-(2,2-difluoroethyl)pyrazol-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-cyclopropyloxy-1-(2,2-difluoroethyl)pyrazol-4-amine?
The IUPAC name of 3-cyclopropyloxy-1-(2,2-difluoroethyl)pyrazol-4-amine (CID 146569693) is 3-cyclopropyloxy-1-(2,2-difluoroethyl)pyrazol-4-amine.
What is the SMILES notation for 3-cyclopropyloxy-1-(2,2-difluoroethyl)pyrazol-4-amine?
The canonical SMILES for 3-cyclopropyloxy-1-(2,2-difluoroethyl)pyrazol-4-amine is Nc1cn(CC(F)F)nc1OC1CC1.
What is the InChIKey of 3-cyclopropyloxy-1-(2,2-difluoroethyl)pyrazol-4-amine?
The InChIKey is GVPRNKDJIBKWNQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11F2N3O/c9-7(10)4-13-3-6(11)8(12-13)14-5-1-2-5/h3,5,7H,1-2,4,11H2.
What are the key properties of 3-cyclopropyloxy-1-(2,2-difluoroethyl)pyrazol-4-amine?
3-cyclopropyloxy-1-(2,2-difluoroethyl)pyrazol-4-amine has a molecular weight of 203.19 g/mol, XLogP of 1.27, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-cyclopropyloxy-1-(2,2-difluoroethyl)pyrazol-4-amine is sourced from PubChem (CID 146569693), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).