About 3-cyclopropyloxy-1-(2,2-difluoroethyl)-4-nitropyrazole
3-cyclopropyloxy-1-(2,2-difluoroethyl)-4-nitropyrazole (PubChem CID 146569720) has the molecular formula C8H9F2N3O3
and a molecular weight of 233.17 g/mol. Its IUPAC name is 3-cyclopropyloxy-1-(2,2-difluoroethyl)-4-nitropyrazole.
Molecular Properties
| Compound Name | 3-cyclopropyloxy-1-(2,2-difluoroethyl)-4-nitropyrazole |
| PubChem CID | 146569720 |
| Molecular Formula | C8H9F2N3O3 |
| Molecular Weight | 233.17 g/mol |
| Exact Mass | 233.06 |
| IUPAC Name | 3-cyclopropyloxy-1-(2,2-difluoroethyl)-4-nitropyrazole |
| SMILES | O=[N+]([O-])c1cn(CC(F)F)nc1OC1CC1 |
| InChI | InChI=1S/C8H9F2N3O3/c9-7(10)4-12-3-6(13(14)15)8(11-12)16-5-1-2-5/h3,5,7H,1-2,4H2 |
| InChIKey | DYDFOOZFQLGZCD-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 70.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.17 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-cyclopropyloxy-1-(2,2-difluoroethyl)-4-nitropyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-cyclopropyloxy-1-(2,2-difluoroethyl)-4-nitropyrazole?
The IUPAC name of 3-cyclopropyloxy-1-(2,2-difluoroethyl)-4-nitropyrazole (CID 146569720) is 3-cyclopropyloxy-1-(2,2-difluoroethyl)-4-nitropyrazole.
What is the SMILES notation for 3-cyclopropyloxy-1-(2,2-difluoroethyl)-4-nitropyrazole?
The canonical SMILES for 3-cyclopropyloxy-1-(2,2-difluoroethyl)-4-nitropyrazole is O=[N+]([O-])c1cn(CC(F)F)nc1OC1CC1.
What is the InChIKey of 3-cyclopropyloxy-1-(2,2-difluoroethyl)-4-nitropyrazole?
The InChIKey is DYDFOOZFQLGZCD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9F2N3O3/c9-7(10)4-12-3-6(13(14)15)8(11-12)16-5-1-2-5/h3,5,7H,1-2,4H2.
What are the key properties of 3-cyclopropyloxy-1-(2,2-difluoroethyl)-4-nitropyrazole?
3-cyclopropyloxy-1-(2,2-difluoroethyl)-4-nitropyrazole has a molecular weight of 233.17 g/mol, XLogP of 1.60, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-cyclopropyloxy-1-(2,2-difluoroethyl)-4-nitropyrazole is sourced from PubChem (CID 146569720), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).