C24H26FN7O4 — CID 146570103
5-[1-[(3R,4S)-3-fluorooxan-4-yl]pyrrolo[2,3-b]pyridin-3-yl]-N-[(3R,4R)-4-hydroxyoxolan-3-yl]-7-(methylamino)pyrazolo[1,5-a]pyrimidine-3-carboxamide (PubChem CID 146570103) has the molecular formula C24H26FN7O4 and a molecular weight of 495.52 g/mol. Its IUPAC name is 5-[1-[(3R,4S)-3-fluorooxan-4-yl]pyrrolo[2,3-b]pyridin-3-yl]-N-[(3R,4R)-4-hydroxyoxolan-3-yl]-7-(methylamino)pyrazolo[1,5-a]pyrimidine-3-carboxamide.
| Compound Name | 5-[1-[(3R,4S)-3-fluorooxan-4-yl]pyrrolo[2,3-b]pyridin-3-yl]-N-[(3R,4R)-4-hydroxyoxolan-3-yl]-7-(methylamino)pyrazolo[1,5-a]pyrimidine-3-carboxamide |
|---|---|
| PubChem CID | 146570103 |
| Molecular Formula | C24H26FN7O4 |
| Molecular Weight | 495.52 g/mol |
| Exact Mass | 495.20 |
| IUPAC Name | 5-[1-[(3R,4S)-3-fluorooxan-4-yl]pyrrolo[2,3-b]pyridin-3-yl]-N-[(3R,4R)-4-hydroxyoxolan-3-yl]-7-(methylamino)pyrazolo[1,5-a]pyrimidine-3-carboxamide |
| SMILES | CNc1cc(-c2cn([C@H]3CCOC[C@@H]3F)c3ncccc23)nc2c(C(=O)N[C@@H]3COC[C@@H]3O)cnn12 |
| InChI | InChI=1S/C24H26FN7O4/c1-26-21-7-17(29-23-14(8-28-32(21)23)24(34)30-18-11-36-12-20(18)33)15-9-31(19-4-6-35-10-16(19)25)22-13(15)3-2-5-27-22/h2-3,5,7-9,16,18-20,26,33H,4,6,10-12H2,1H3,(H,30,34)/t16-,18+,19-,20-/m0/s1 |
| InChIKey | AGZPZNRTAMSAHZ-RNQOJCNYSA-N |
| XLogP | 1.58 |
| TPSA | 127.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.52 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |