C24H26FN7O3 — CID 146570136
5-[1-[(3S,4R)-3-fluorooxan-4-yl]pyrrolo[2,3-b]pyridin-3-yl]-N-[(1R,2S)-2-hydroxycyclobutyl]-7-(methylamino)pyrazolo[1,5-a]pyrimidine-3-carboxamide (PubChem CID 146570136) has the molecular formula C24H26FN7O3 and a molecular weight of 479.52 g/mol. Its IUPAC name is 5-[1-[(3S,4R)-3-fluorooxan-4-yl]pyrrolo[2,3-b]pyridin-3-yl]-N-[(1R,2S)-2-hydroxycyclobutyl]-7-(methylamino)pyrazolo[1,5-a]pyrimidine-3-carboxamide.
| Compound Name | 5-[1-[(3S,4R)-3-fluorooxan-4-yl]pyrrolo[2,3-b]pyridin-3-yl]-N-[(1R,2S)-2-hydroxycyclobutyl]-7-(methylamino)pyrazolo[1,5-a]pyrimidine-3-carboxamide |
|---|---|
| PubChem CID | 146570136 |
| Molecular Formula | C24H26FN7O3 |
| Molecular Weight | 479.52 g/mol |
| Exact Mass | 479.21 |
| IUPAC Name | 5-[1-[(3S,4R)-3-fluorooxan-4-yl]pyrrolo[2,3-b]pyridin-3-yl]-N-[(1R,2S)-2-hydroxycyclobutyl]-7-(methylamino)pyrazolo[1,5-a]pyrimidine-3-carboxamide |
| SMILES | CNc1cc(-c2cn([C@@H]3CCOC[C@H]3F)c3ncccc23)nc2c(C(=O)N[C@@H]3CC[C@@H]3O)cnn12 |
| InChI | InChI=1S/C24H26FN7O3/c1-26-21-9-18(29-23-14(10-28-32(21)23)24(34)30-17-4-5-20(17)33)15-11-31(19-6-8-35-12-16(19)25)22-13(15)3-2-7-27-22/h2-3,7,9-11,16-17,19-20,26,33H,4-6,8,12H2,1H3,(H,30,34)/t16-,17-,19-,20+/m1/s1 |
| InChIKey | CRXLHRGWQKJICC-LFGUQSLTSA-N |
| XLogP | 2.34 |
| TPSA | 118.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.52 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |