About [amino-[3-fluoro-5-(2-hydroxypropan-2-yl)thiophen-2-yl]-oxo-λ6-sulfanylidene]carbamic acid
[amino-[3-fluoro-5-(2-hydroxypropan-2-yl)thiophen-2-yl]-oxo-λ6-sulfanylidene]carbamic acid (PubChem CID 146570500) has the molecular formula C8H11FN2O4S2
and a molecular weight of 282.32 g/mol. Its IUPAC name is [amino-[3-fluoro-5-(2-hydroxypropan-2-yl)thiophen-2-yl]-oxo-λ6-sulfanylidene]carbamic acid.
Molecular Properties
| Compound Name | [amino-[3-fluoro-5-(2-hydroxypropan-2-yl)thiophen-2-yl]-oxo-λ6-sulfanylidene]carbamic acid |
| PubChem CID | 146570500 |
| Molecular Formula | C8H11FN2O4S2 |
| Molecular Weight | 282.32 g/mol |
| Exact Mass | 282.01 |
| IUPAC Name | [amino-[3-fluoro-5-(2-hydroxypropan-2-yl)thiophen-2-yl]-oxo-λ6-sulfanylidene]carbamic acid |
| SMILES | CC(C)(O)c1cc(F)c(S(N)(=O)=NC(=O)O)s1 |
| InChI | InChI=1S/C8H11FN2O4S2/c1-8(2,14)5-3-4(9)6(16-5)17(10,15)11-7(12)13/h3,14H,1-2H3,(H,12,13)(H2,10,11,15) |
| InChIKey | VCTGHYIEDCCSRN-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 112.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.32 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [amino-[3-fluoro-5-(2-hydroxypropan-2-yl)thiophen-2-yl]-oxo-λ6-sulfanylidene]carbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [amino-[3-fluoro-5-(2-hydroxypropan-2-yl)thiophen-2-yl]-oxo-λ6-sulfanylidene]carbamic acid?
The IUPAC name of [amino-[3-fluoro-5-(2-hydroxypropan-2-yl)thiophen-2-yl]-oxo-λ6-sulfanylidene]carbamic acid (CID 146570500) is [amino-[3-fluoro-5-(2-hydroxypropan-2-yl)thiophen-2-yl]-oxo-λ6-sulfanylidene]carbamic acid.
What is the SMILES notation for [amino-[3-fluoro-5-(2-hydroxypropan-2-yl)thiophen-2-yl]-oxo-λ6-sulfanylidene]carbamic acid?
The canonical SMILES for [amino-[3-fluoro-5-(2-hydroxypropan-2-yl)thiophen-2-yl]-oxo-λ6-sulfanylidene]carbamic acid is CC(C)(O)c1cc(F)c(S(N)(=O)=NC(=O)O)s1.
What is the InChIKey of [amino-[3-fluoro-5-(2-hydroxypropan-2-yl)thiophen-2-yl]-oxo-λ6-sulfanylidene]carbamic acid?
The InChIKey is VCTGHYIEDCCSRN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11FN2O4S2/c1-8(2,14)5-3-4(9)6(16-5)17(10,15)11-7(12)13/h3,14H,1-2H3,(H,12,13)(H2,10,11,15).
What are the key properties of [amino-[3-fluoro-5-(2-hydroxypropan-2-yl)thiophen-2-yl]-oxo-λ6-sulfanylidene]carbamic acid?
[amino-[3-fluoro-5-(2-hydroxypropan-2-yl)thiophen-2-yl]-oxo-λ6-sulfanylidene]carbamic acid has a molecular weight of 282.32 g/mol, XLogP of 1.49, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [amino-[3-fluoro-5-(2-hydroxypropan-2-yl)thiophen-2-yl]-oxo-λ6-sulfanylidene]carbamic acid is sourced from PubChem (CID 146570500), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).