C13H15F2NO2 — CID 146570509
2,2-difluoro-4-propan-2-yl-7,8-dihydro-6H-cyclopenta[g][1,3]benzodioxol-5-amine (PubChem CID 146570509) has the molecular formula C13H15F2NO2 and a molecular weight of 255.26 g/mol. Its IUPAC name is 2,2-difluoro-4-propan-2-yl-7,8-dihydro-6H-cyclopenta[g][1,3]benzodioxol-5-amine.
| Compound Name | 2,2-difluoro-4-propan-2-yl-7,8-dihydro-6H-cyclopenta[g][1,3]benzodioxol-5-amine |
|---|---|
| PubChem CID | 146570509 |
| Molecular Formula | C13H15F2NO2 |
| Molecular Weight | 255.26 g/mol |
| Exact Mass | 255.11 |
| IUPAC Name | 2,2-difluoro-4-propan-2-yl-7,8-dihydro-6H-cyclopenta[g][1,3]benzodioxol-5-amine |
| SMILES | CC(C)c1c(N)c2c(c3c1OC(F)(F)O3)CCC2 |
| InChI | InChI=1S/C13H15F2NO2/c1-6(2)9-10(16)7-4-3-5-8(7)11-12(9)18-13(14,15)17-11/h6H,3-5,16H2,1-2H3 |
| InChIKey | RFNKRIWCOJDLSR-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.26 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|