C18H21N3O3S2 — CID 146570881
[2-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)-1,3-thiazol-5-yl]-(3-methylsulfonylphenyl)methanone (PubChem CID 146570881) has the molecular formula C18H21N3O3S2 and a molecular weight of 391.52 g/mol. Its IUPAC name is [2-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)-1,3-thiazol-5-yl]-(3-methylsulfonylphenyl)methanone.
| Compound Name | [2-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)-1,3-thiazol-5-yl]-(3-methylsulfonylphenyl)methanone |
|---|---|
| PubChem CID | 146570881 |
| Molecular Formula | C18H21N3O3S2 |
| Molecular Weight | 391.52 g/mol |
| Exact Mass | 391.10 |
| IUPAC Name | [2-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)-1,3-thiazol-5-yl]-(3-methylsulfonylphenyl)methanone |
| SMILES | CS(=O)(=O)c1cccc(C(=O)c2cnc(N3CCN4CCCC4C3)s2)c1 |
| InChI | InChI=1S/C18H21N3O3S2/c1-26(23,24)15-6-2-4-13(10-15)17(22)16-11-19-18(25-16)21-9-8-20-7-3-5-14(20)12-21/h2,4,6,10-11,14H,3,5,7-9,12H2,1H3 |
| InChIKey | BJVISMQGJPKDNG-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 70.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.52 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |