C6H10N2O4S2 — CID 146571011
2-[(2S)-1,2-dihydroxypropan-2-yl]-1,3-thiazole-5-sulfonamide (PubChem CID 146571011) has the molecular formula C6H10N2O4S2 and a molecular weight of 238.29 g/mol. Its IUPAC name is 2-[(2S)-1,2-dihydroxypropan-2-yl]-1,3-thiazole-5-sulfonamide.
| Compound Name | 2-[(2S)-1,2-dihydroxypropan-2-yl]-1,3-thiazole-5-sulfonamide |
|---|---|
| PubChem CID | 146571011 |
| Molecular Formula | C6H10N2O4S2 |
| Molecular Weight | 238.29 g/mol |
| Exact Mass | 238.01 |
| IUPAC Name | 2-[(2S)-1,2-dihydroxypropan-2-yl]-1,3-thiazole-5-sulfonamide |
| SMILES | C[C@](O)(CO)c1ncc(S(N)(=O)=O)s1 |
| InChI | InChI=1S/C6H10N2O4S2/c1-6(10,3-9)5-8-2-4(13-5)14(7,11)12/h2,9-10H,3H2,1H3,(H2,7,11,12)/t6-/m0/s1 |
| InChIKey | ACSWCCNHZMRQMB-LURJTMIESA-N |
| XLogP | -1.01 |
| TPSA | 113.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.29 |
| LogP ≤ 5 | -1.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |