C25H28N4O3S — CID 146571174
1-[6-[(cyclopropylmethylamino)methyl]-1,3-dioxo-1,2-benzothiazol-1-ylidene]-3-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)urea (PubChem CID 146571174) has the molecular formula C25H28N4O3S and a molecular weight of 464.59 g/mol. Its IUPAC name is 1-[6-[(cyclopropylmethylamino)methyl]-1,3-dioxo-1,2-benzothiazol-1-ylidene]-3-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)urea.
| Compound Name | 1-[6-[(cyclopropylmethylamino)methyl]-1,3-dioxo-1,2-benzothiazol-1-ylidene]-3-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)urea |
|---|---|
| PubChem CID | 146571174 |
| Molecular Formula | C25H28N4O3S |
| Molecular Weight | 464.59 g/mol |
| Exact Mass | 464.19 |
| IUPAC Name | 1-[6-[(cyclopropylmethylamino)methyl]-1,3-dioxo-1,2-benzothiazol-1-ylidene]-3-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)urea |
| SMILES | O=C(N=S1(=O)NC(=O)c2ccc(CNCC3CC3)cc21)Nc1c2c(cc3c1CCC3)CCC2 |
| InChI | InChI=1S/C25H28N4O3S/c30-24-21-10-9-16(14-26-13-15-7-8-15)11-22(21)33(32,28-24)29-25(31)27-23-19-5-1-3-17(19)12-18-4-2-6-20(18)23/h9-12,15,26H,1-8,13-14H2,(H2,27,28,29,30,31,32) |
| InChIKey | BIOHYMLZJWTDLU-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 99.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.59 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |