About 1-(1,1-difluoroethyl)pyrazole-3-sulfonamide
1-(1,1-difluoroethyl)pyrazole-3-sulfonamide (PubChem CID 146571437) has the molecular formula C5H7F2N3O2S
and a molecular weight of 211.19 g/mol. Its IUPAC name is 1-(1,1-difluoroethyl)pyrazole-3-sulfonamide.
Molecular Properties
| Compound Name | 1-(1,1-difluoroethyl)pyrazole-3-sulfonamide |
| PubChem CID | 146571437 |
| Molecular Formula | C5H7F2N3O2S |
| Molecular Weight | 211.19 g/mol |
| Exact Mass | 211.02 |
| IUPAC Name | 1-(1,1-difluoroethyl)pyrazole-3-sulfonamide |
| SMILES | CC(F)(F)n1ccc(S(N)(=O)=O)n1 |
| InChI | InChI=1S/C5H7F2N3O2S/c1-5(6,7)10-3-2-4(9-10)13(8,11)12/h2-3H,1H3,(H2,8,11,12) |
| InChIKey | YCTLJMJGGCSFSB-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 77.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.19 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(1,1-difluoroethyl)pyrazole-3-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1,1-difluoroethyl)pyrazole-3-sulfonamide?
The IUPAC name of 1-(1,1-difluoroethyl)pyrazole-3-sulfonamide (CID 146571437) is 1-(1,1-difluoroethyl)pyrazole-3-sulfonamide.
What is the SMILES notation for 1-(1,1-difluoroethyl)pyrazole-3-sulfonamide?
The canonical SMILES for 1-(1,1-difluoroethyl)pyrazole-3-sulfonamide is CC(F)(F)n1ccc(S(N)(=O)=O)n1.
What is the InChIKey of 1-(1,1-difluoroethyl)pyrazole-3-sulfonamide?
The InChIKey is YCTLJMJGGCSFSB-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7F2N3O2S/c1-5(6,7)10-3-2-4(9-10)13(8,11)12/h2-3H,1H3,(H2,8,11,12).
What are the key properties of 1-(1,1-difluoroethyl)pyrazole-3-sulfonamide?
1-(1,1-difluoroethyl)pyrazole-3-sulfonamide has a molecular weight of 211.19 g/mol, XLogP of 0.10, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1,1-difluoroethyl)pyrazole-3-sulfonamide is sourced from PubChem (CID 146571437), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).