About 5-amino-4-(7-bromo-5,6-difluoro-3-oxo-1H-isoindol-2-yl)-5-oxopentanoic acid
5-amino-4-(7-bromo-5,6-difluoro-3-oxo-1H-isoindol-2-yl)-5-oxopentanoic acid (PubChem CID 146571559) has the molecular formula C13H11BrF2N2O4
and a molecular weight of 377.14 g/mol. Its IUPAC name is 5-amino-4-(7-bromo-5,6-difluoro-3-oxo-1H-isoindol-2-yl)-5-oxopentanoic acid.
Molecular Properties
| Compound Name | 5-amino-4-(7-bromo-5,6-difluoro-3-oxo-1H-isoindol-2-yl)-5-oxopentanoic acid |
| PubChem CID | 146571559 |
| Molecular Formula | C13H11BrF2N2O4 |
| Molecular Weight | 377.14 g/mol |
| Exact Mass | 375.99 |
| IUPAC Name | 5-amino-4-(7-bromo-5,6-difluoro-3-oxo-1H-isoindol-2-yl)-5-oxopentanoic acid |
| SMILES | NC(=O)C(CCC(=O)O)N1Cc2c(cc(F)c(F)c2Br)C1=O |
| InChI | InChI=1S/C13H11BrF2N2O4/c14-10-6-4-18(8(12(17)21)1-2-9(19)20)13(22)5(6)3-7(15)11(10)16/h3,8H,1-2,4H2,(H2,17,21)(H,19,20) |
| InChIKey | KFOHEIDDMQXHDS-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 100.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 377.14 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|
Analyze 5-amino-4-(7-bromo-5,6-difluoro-3-oxo-1H-isoindol-2-yl)-5-oxopentanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-amino-4-(7-bromo-5,6-difluoro-3-oxo-1H-isoindol-2-yl)-5-oxopentanoic acid?
The IUPAC name of 5-amino-4-(7-bromo-5,6-difluoro-3-oxo-1H-isoindol-2-yl)-5-oxopentanoic acid (CID 146571559) is 5-amino-4-(7-bromo-5,6-difluoro-3-oxo-1H-isoindol-2-yl)-5-oxopentanoic acid.
What is the SMILES notation for 5-amino-4-(7-bromo-5,6-difluoro-3-oxo-1H-isoindol-2-yl)-5-oxopentanoic acid?
The canonical SMILES for 5-amino-4-(7-bromo-5,6-difluoro-3-oxo-1H-isoindol-2-yl)-5-oxopentanoic acid is NC(=O)C(CCC(=O)O)N1Cc2c(cc(F)c(F)c2Br)C1=O.
What is the InChIKey of 5-amino-4-(7-bromo-5,6-difluoro-3-oxo-1H-isoindol-2-yl)-5-oxopentanoic acid?
The InChIKey is KFOHEIDDMQXHDS-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11BrF2N2O4/c14-10-6-4-18(8(12(17)21)1-2-9(19)20)13(22)5(6)3-7(15)11(10)16/h3,8H,1-2,4H2,(H2,17,21)(H,19,20).
What are the key properties of 5-amino-4-(7-bromo-5,6-difluoro-3-oxo-1H-isoindol-2-yl)-5-oxopentanoic acid?
5-amino-4-(7-bromo-5,6-difluoro-3-oxo-1H-isoindol-2-yl)-5-oxopentanoic acid has a molecular weight of 377.14 g/mol, XLogP of 1.40, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-amino-4-(7-bromo-5,6-difluoro-3-oxo-1H-isoindol-2-yl)-5-oxopentanoic acid is sourced from PubChem (CID 146571559), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).