C17H15F2N3S2 — CID 146572114
4-[2-[(2,4-difluorophenyl)methylsulfanyl]ethyl]-3-phenyl-1H-1,2,4-triazole-5-thione (PubChem CID 146572114) has the molecular formula C17H15F2N3S2 and a molecular weight of 363.46 g/mol. Its IUPAC name is 4-[2-[(2,4-difluorophenyl)methylsulfanyl]ethyl]-3-phenyl-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-[2-[(2,4-difluorophenyl)methylsulfanyl]ethyl]-3-phenyl-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 146572114 |
| Molecular Formula | C17H15F2N3S2 |
| Molecular Weight | 363.46 g/mol |
| Exact Mass | 363.07 |
| IUPAC Name | 4-[2-[(2,4-difluorophenyl)methylsulfanyl]ethyl]-3-phenyl-1H-1,2,4-triazole-5-thione |
| SMILES | Fc1ccc(CSCCn2c(-c3ccccc3)n[nH]c2=S)c(F)c1 |
| InChI | InChI=1S/C17H15F2N3S2/c18-14-7-6-13(15(19)10-14)11-24-9-8-22-16(20-21-17(22)23)12-4-2-1-3-5-12/h1-7,10H,8-9,11H2,(H,21,23) |
| InChIKey | MMPWXHQLSYMVBP-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 33.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.46 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|