C11H12F3N3O5 — CID 146572159
3-[4-(methylcarbamoyl)pyridazin-1-ium-1-yl]propanoic acid;2,2,2-trifluoroacetate (PubChem CID 146572159) has the molecular formula C11H12F3N3O5 and a molecular weight of 323.23 g/mol. Its IUPAC name is 3-[4-(methylcarbamoyl)pyridazin-1-ium-1-yl]propanoic acid;2,2,2-trifluoroacetate.
| Compound Name | 3-[4-(methylcarbamoyl)pyridazin-1-ium-1-yl]propanoic acid;2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 146572159 |
| Molecular Formula | C11H12F3N3O5 |
| Molecular Weight | 323.23 g/mol |
| Exact Mass | 323.07 |
| IUPAC Name | 3-[4-(methylcarbamoyl)pyridazin-1-ium-1-yl]propanoic acid;2,2,2-trifluoroacetate |
| SMILES | CNC(=O)c1cc[n+](CCC(=O)O)nc1.O=C([O-])C(F)(F)F |
| InChI | InChI=1S/C9H11N3O3.C2HF3O2/c1-10-9(15)7-2-4-12(11-6-7)5-3-8(13)14;3-2(4,5)1(6)7/h2,4,6H,3,5H2,1H3,(H-,10,13,14,15);(H,6,7) |
| InChIKey | SUPMQYYHUNRZHN-UHFFFAOYSA-N |
| XLogP | -1.50 |
| TPSA | 123.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.23 |
| LogP ≤ 5 | -1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|