C42H69N — CID 146572259
(2E,4E,6E,8E)-7-methyl-9-(1,2,2,6-tetramethylcyclohexyl)-N-[(E)-3,3,7,7-tetramethyl-9-(2,6,6-trimethylcyclohexen-1-yl)non-4-enyl]nona-2,4,6,8-tetraen-1-imine (PubChem CID 146572259) has the molecular formula C42H69N and a molecular weight of 588.02 g/mol. Its IUPAC name is (2E,4E,6E,8E)-7-methyl-9-(1,2,2,6-tetramethylcyclohexyl)-N-[(E)-3,3,7,7-tetramethyl-9-(2,6,6-trimethylcyclohexen-1-yl)non-4-enyl]nona-2,4,6,8-tetraen-1-imine.
| Compound Name | (2E,4E,6E,8E)-7-methyl-9-(1,2,2,6-tetramethylcyclohexyl)-N-[(E)-3,3,7,7-tetramethyl-9-(2,6,6-trimethylcyclohexen-1-yl)non-4-enyl]nona-2,4,6,8-tetraen-1-imine |
|---|---|
| PubChem CID | 146572259 |
| Molecular Formula | C42H69N |
| Molecular Weight | 588.02 g/mol |
| Exact Mass | 587.54 |
| IUPAC Name | (2E,4E,6E,8E)-7-methyl-9-(1,2,2,6-tetramethylcyclohexyl)-N-[(E)-3,3,7,7-tetramethyl-9-(2,6,6-trimethylcyclohexen-1-yl)non-4-enyl]nona-2,4,6,8-tetraen-1-imine |
| SMILES | CC1=C(CCC(C)(C)C/C=C/C(C)(C)CC/N=C/C=C/C=C/C=C(C)/C=C/C2(C)C(C)CCCC2(C)C)C(C)(C)CCC1 |
| InChI | InChI=1S/C42H69N/c1-34(23-30-42(12)36(3)22-18-28-41(42,10)11)20-15-13-14-16-32-43-33-31-39(6,7)26-19-25-38(4,5)29-24-37-35(2)21-17-27-40(37,8)9/h13-16,19-20,23,26,30,32,36H,17-18,21-22,24-25,27-29,31,33H2,1-12H3/b15-13+,16-14+,26-19+,30-23+,34-20+,43-32+ |
| InChIKey | PKWITJSBAPMFIV-IHVPUWSQSA-N |
| XLogP | 13.22 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.02 |
| LogP ≤ 5 | 13.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|