C19H20F3NO — CID 146572380
4,4-difluoro-1-(3-fluoro-4-phenylmethoxyphenyl)cyclohexan-1-amine (PubChem CID 146572380) has the molecular formula C19H20F3NO and a molecular weight of 335.37 g/mol. Its IUPAC name is 4,4-difluoro-1-(3-fluoro-4-phenylmethoxyphenyl)cyclohexan-1-amine.
| Compound Name | 4,4-difluoro-1-(3-fluoro-4-phenylmethoxyphenyl)cyclohexan-1-amine |
|---|---|
| PubChem CID | 146572380 |
| Molecular Formula | C19H20F3NO |
| Molecular Weight | 335.37 g/mol |
| Exact Mass | 335.15 |
| IUPAC Name | 4,4-difluoro-1-(3-fluoro-4-phenylmethoxyphenyl)cyclohexan-1-amine |
| SMILES | NC1(c2ccc(OCc3ccccc3)c(F)c2)CCC(F)(F)CC1 |
| InChI | InChI=1S/C19H20F3NO/c20-16-12-15(18(23)8-10-19(21,22)11-9-18)6-7-17(16)24-13-14-4-2-1-3-5-14/h1-7,12H,8-11,13,23H2 |
| InChIKey | LLHXDJWDERIKBO-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.37 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |