C13H20F3N3 — CID 146573445
(2E,4Z)-1,1,1-trifluoro-6-[(4-methylpiperazin-1-yl)methyl]hepta-2,4,6-trien-3-amine (PubChem CID 146573445) has the molecular formula C13H20F3N3 and a molecular weight of 275.32 g/mol. Its IUPAC name is (2E,4Z)-1,1,1-trifluoro-6-[(4-methylpiperazin-1-yl)methyl]hepta-2,4,6-trien-3-amine.
| Compound Name | (2E,4Z)-1,1,1-trifluoro-6-[(4-methylpiperazin-1-yl)methyl]hepta-2,4,6-trien-3-amine |
|---|---|
| PubChem CID | 146573445 |
| Molecular Formula | C13H20F3N3 |
| Molecular Weight | 275.32 g/mol |
| Exact Mass | 275.16 |
| IUPAC Name | (2E,4Z)-1,1,1-trifluoro-6-[(4-methylpiperazin-1-yl)methyl]hepta-2,4,6-trien-3-amine |
| SMILES | C=C(/C=C\C(N)=C/C(F)(F)F)CN1CCN(C)CC1 |
| InChI | InChI=1S/C13H20F3N3/c1-11(3-4-12(17)9-13(14,15)16)10-19-7-5-18(2)6-8-19/h3-4,9H,1,5-8,10,17H2,2H3/b4-3-,12-9+ |
| InChIKey | YNQIPZUZQDFQOE-CVTZKADISA-N |
| XLogP | 1.75 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.32 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|