About 6-methyl-1,2-bis(methylsulfonyl)cyclohexa-1,3-diene
6-methyl-1,2-bis(methylsulfonyl)cyclohexa-1,3-diene (PubChem CID 146573511) has the molecular formula C9H14O4S2
and a molecular weight of 250.34 g/mol. Its IUPAC name is 6-methyl-1,2-bis(methylsulfonyl)cyclohexa-1,3-diene.
Molecular Properties
| Compound Name | 6-methyl-1,2-bis(methylsulfonyl)cyclohexa-1,3-diene |
| PubChem CID | 146573511 |
| Molecular Formula | C9H14O4S2 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.03 |
| IUPAC Name | 6-methyl-1,2-bis(methylsulfonyl)cyclohexa-1,3-diene |
| SMILES | CC1CC=CC(S(C)(=O)=O)=C1S(C)(=O)=O |
| InChI | InChI=1S/C9H14O4S2/c1-7-5-4-6-8(14(2,10)11)9(7)15(3,12)13/h4,6-7H,5H2,1-3H3 |
| InChIKey | YIQSWSKTXGTWTR-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-methyl-1,2-bis(methylsulfonyl)cyclohexa-1,3-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methyl-1,2-bis(methylsulfonyl)cyclohexa-1,3-diene?
The IUPAC name of 6-methyl-1,2-bis(methylsulfonyl)cyclohexa-1,3-diene (CID 146573511) is 6-methyl-1,2-bis(methylsulfonyl)cyclohexa-1,3-diene.
What is the SMILES notation for 6-methyl-1,2-bis(methylsulfonyl)cyclohexa-1,3-diene?
The canonical SMILES for 6-methyl-1,2-bis(methylsulfonyl)cyclohexa-1,3-diene is CC1CC=CC(S(C)(=O)=O)=C1S(C)(=O)=O.
What is the InChIKey of 6-methyl-1,2-bis(methylsulfonyl)cyclohexa-1,3-diene?
The InChIKey is YIQSWSKTXGTWTR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14O4S2/c1-7-5-4-6-8(14(2,10)11)9(7)15(3,12)13/h4,6-7H,5H2,1-3H3.
What are the key properties of 6-methyl-1,2-bis(methylsulfonyl)cyclohexa-1,3-diene?
6-methyl-1,2-bis(methylsulfonyl)cyclohexa-1,3-diene has a molecular weight of 250.34 g/mol, XLogP of 0.88, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methyl-1,2-bis(methylsulfonyl)cyclohexa-1,3-diene is sourced from PubChem (CID 146573511), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).