C13H18N2O2 — CID 146573660
3-[[(3E,5Z)-hepta-1,3,5-trien-3-yl]-methylamino]piperidine-2,6-dione (PubChem CID 146573660) has the molecular formula C13H18N2O2 and a molecular weight of 234.30 g/mol. Its IUPAC name is 3-[[(3E,5Z)-hepta-1,3,5-trien-3-yl]-methylamino]piperidine-2,6-dione.
| Compound Name | 3-[[(3E,5Z)-hepta-1,3,5-trien-3-yl]-methylamino]piperidine-2,6-dione |
|---|---|
| PubChem CID | 146573660 |
| Molecular Formula | C13H18N2O2 |
| Molecular Weight | 234.30 g/mol |
| Exact Mass | 234.14 |
| IUPAC Name | 3-[[(3E,5Z)-hepta-1,3,5-trien-3-yl]-methylamino]piperidine-2,6-dione |
| SMILES | C=C/C(=C\C=C/C)N(C)C1CCC(=O)NC1=O |
| InChI | InChI=1S/C13H18N2O2/c1-4-6-7-10(5-2)15(3)11-8-9-12(16)14-13(11)17/h4-7,11H,2,8-9H2,1,3H3,(H,14,16,17)/b6-4-,10-7+ |
| InChIKey | GSUPIRBDWHDIFZ-BSAFSDHNSA-N |
| XLogP | 1.37 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.30 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|