About 8-amino-3-methyl-1H-1,7-naphthyridin-2-one
8-amino-3-methyl-1H-1,7-naphthyridin-2-one (PubChem CID 146573775) has the molecular formula C9H9N3O
and a molecular weight of 175.19 g/mol. Its IUPAC name is 8-amino-3-methyl-1H-1,7-naphthyridin-2-one.
Molecular Properties
| Compound Name | 8-amino-3-methyl-1H-1,7-naphthyridin-2-one |
| PubChem CID | 146573775 |
| Molecular Formula | C9H9N3O |
| Molecular Weight | 175.19 g/mol |
| Exact Mass | 175.07 |
| IUPAC Name | 8-amino-3-methyl-1H-1,7-naphthyridin-2-one |
| SMILES | Cc1cc2ccnc(N)c2[nH]c1=O |
| InChI | InChI=1S/C9H9N3O/c1-5-4-6-2-3-11-8(10)7(6)12-9(5)13/h2-4H,1H3,(H2,10,11)(H,12,13) |
| InChIKey | HQSPDAABBNRODU-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 71.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.19 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 8-amino-3-methyl-1H-1,7-naphthyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-amino-3-methyl-1H-1,7-naphthyridin-2-one?
The IUPAC name of 8-amino-3-methyl-1H-1,7-naphthyridin-2-one (CID 146573775) is 8-amino-3-methyl-1H-1,7-naphthyridin-2-one.
What is the SMILES notation for 8-amino-3-methyl-1H-1,7-naphthyridin-2-one?
The canonical SMILES for 8-amino-3-methyl-1H-1,7-naphthyridin-2-one is Cc1cc2ccnc(N)c2[nH]c1=O.
What is the InChIKey of 8-amino-3-methyl-1H-1,7-naphthyridin-2-one?
The InChIKey is HQSPDAABBNRODU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9N3O/c1-5-4-6-2-3-11-8(10)7(6)12-9(5)13/h2-4H,1H3,(H2,10,11)(H,12,13).
What are the key properties of 8-amino-3-methyl-1H-1,7-naphthyridin-2-one?
8-amino-3-methyl-1H-1,7-naphthyridin-2-one has a molecular weight of 175.19 g/mol, XLogP of 0.81, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-amino-3-methyl-1H-1,7-naphthyridin-2-one is sourced from PubChem (CID 146573775), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).