C11H14N4O3 — CID 146574384
3-(4,5,6,7-tetrahydropyrazolo[1,5-a]pyrazin-2-yloxy)piperidine-2,6-dione (PubChem CID 146574384) has the molecular formula C11H14N4O3 and a molecular weight of 250.26 g/mol. Its IUPAC name is 3-(4,5,6,7-tetrahydropyrazolo[1,5-a]pyrazin-2-yloxy)piperidine-2,6-dione.
| Compound Name | 3-(4,5,6,7-tetrahydropyrazolo[1,5-a]pyrazin-2-yloxy)piperidine-2,6-dione |
|---|---|
| PubChem CID | 146574384 |
| Molecular Formula | C11H14N4O3 |
| Molecular Weight | 250.26 g/mol |
| Exact Mass | 250.11 |
| IUPAC Name | 3-(4,5,6,7-tetrahydropyrazolo[1,5-a]pyrazin-2-yloxy)piperidine-2,6-dione |
| SMILES | O=C1CCC(Oc2cc3n(n2)CCNC3)C(=O)N1 |
| InChI | InChI=1S/C11H14N4O3/c16-9-2-1-8(11(17)13-9)18-10-5-7-6-12-3-4-15(7)14-10/h5,8,12H,1-4,6H2,(H,13,16,17) |
| InChIKey | NVRCOGBMMWDSSY-UHFFFAOYSA-N |
| XLogP | -0.83 |
| TPSA | 85.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.26 |
| LogP ≤ 5 | -0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|