About (E)-N,3-bis(ethenyl)-4-methyl-4-propyloct-2-en-1-imine
(E)-N,3-bis(ethenyl)-4-methyl-4-propyloct-2-en-1-imine (PubChem CID 146575815) has the molecular formula C16H27N
and a molecular weight of 233.40 g/mol. Its IUPAC name is (E)-N,3-bis(ethenyl)-4-methyl-4-propyloct-2-en-1-imine.
Molecular Properties
| Compound Name | (E)-N,3-bis(ethenyl)-4-methyl-4-propyloct-2-en-1-imine |
| PubChem CID | 146575815 |
| Molecular Formula | C16H27N |
| Molecular Weight | 233.40 g/mol |
| Exact Mass | 233.21 |
| IUPAC Name | (E)-N,3-bis(ethenyl)-4-methyl-4-propyloct-2-en-1-imine |
| SMILES | C=C/N=C/C=C(\C=C)C(C)(CCC)CCCC |
| InChI | InChI=1S/C16H27N/c1-6-10-13-16(5,12-7-2)15(8-3)11-14-17-9-4/h8-9,11,14H,3-4,6-7,10,12-13H2,1-2,5H3/b15-11+,17-14+ |
| InChIKey | LRFKHYRZOOHIDJ-WINJFPGJSA-N |
| XLogP | 5.31 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 233.40 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (E)-N,3-bis(ethenyl)-4-methyl-4-propyloct-2-en-1-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-N,3-bis(ethenyl)-4-methyl-4-propyloct-2-en-1-imine?
The IUPAC name of (E)-N,3-bis(ethenyl)-4-methyl-4-propyloct-2-en-1-imine (CID 146575815) is (E)-N,3-bis(ethenyl)-4-methyl-4-propyloct-2-en-1-imine.
What is the SMILES notation for (E)-N,3-bis(ethenyl)-4-methyl-4-propyloct-2-en-1-imine?
The canonical SMILES for (E)-N,3-bis(ethenyl)-4-methyl-4-propyloct-2-en-1-imine is C=C/N=C/C=C(\C=C)C(C)(CCC)CCCC.
What is the InChIKey of (E)-N,3-bis(ethenyl)-4-methyl-4-propyloct-2-en-1-imine?
The InChIKey is LRFKHYRZOOHIDJ-WINJFPGJSA-N. The full InChI is InChI=1S/C16H27N/c1-6-10-13-16(5,12-7-2)15(8-3)11-14-17-9-4/h8-9,11,14H,3-4,6-7,10,12-13H2,1-2,5H3/b15-11+,17-14+.
What are the key properties of (E)-N,3-bis(ethenyl)-4-methyl-4-propyloct-2-en-1-imine?
(E)-N,3-bis(ethenyl)-4-methyl-4-propyloct-2-en-1-imine has a molecular weight of 233.40 g/mol, XLogP of 5.31, 9 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-N,3-bis(ethenyl)-4-methyl-4-propyloct-2-en-1-imine is sourced from PubChem (CID 146575815), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).