C21H20N2O4S — CID 146575873
N-[4-cyclopropyloxy-3-(2-methyl-1-oxoisoquinolin-4-yl)phenyl]ethenesulfonamide (PubChem CID 146575873) has the molecular formula C21H20N2O4S and a molecular weight of 396.47 g/mol. Its IUPAC name is N-[4-cyclopropyloxy-3-(2-methyl-1-oxoisoquinolin-4-yl)phenyl]ethenesulfonamide.
| Compound Name | N-[4-cyclopropyloxy-3-(2-methyl-1-oxoisoquinolin-4-yl)phenyl]ethenesulfonamide |
|---|---|
| PubChem CID | 146575873 |
| Molecular Formula | C21H20N2O4S |
| Molecular Weight | 396.47 g/mol |
| Exact Mass | 396.11 |
| IUPAC Name | N-[4-cyclopropyloxy-3-(2-methyl-1-oxoisoquinolin-4-yl)phenyl]ethenesulfonamide |
| SMILES | C=CS(=O)(=O)Nc1ccc(OC2CC2)c(-c2cn(C)c(=O)c3ccccc23)c1 |
| InChI | InChI=1S/C21H20N2O4S/c1-3-28(25,26)22-14-8-11-20(27-15-9-10-15)18(12-14)19-13-23(2)21(24)17-7-5-4-6-16(17)19/h3-8,11-13,15,22H,1,9-10H2,2H3 |
| InChIKey | LTPOWFHVWQZPIS-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 77.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.47 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |