C14H24N2 — CID 146577227
3-N,4-N-bis(ethenyl)-2,2,5,5-tetramethylhexane-3,4-diimine (PubChem CID 146577227) has the molecular formula C14H24N2 and a molecular weight of 220.36 g/mol. Its IUPAC name is 3-N,4-N-bis(ethenyl)-2,2,5,5-tetramethylhexane-3,4-diimine.
| Compound Name | 3-N,4-N-bis(ethenyl)-2,2,5,5-tetramethylhexane-3,4-diimine |
|---|---|
| PubChem CID | 146577227 |
| Molecular Formula | C14H24N2 |
| Molecular Weight | 220.36 g/mol |
| Exact Mass | 220.19 |
| IUPAC Name | 3-N,4-N-bis(ethenyl)-2,2,5,5-tetramethylhexane-3,4-diimine |
| SMILES | C=C/N=C(C(=N/C=C)/C(C)(C)C)\C(C)(C)C |
| InChI | InChI=1S/C14H24N2/c1-9-15-11(13(3,4)5)12(16-10-2)14(6,7)8/h9-10H,1-2H2,3-8H3/b15-11-,16-12- |
| InChIKey | QAGGATCDRFMMQJ-NFLUSIDLSA-N |
| XLogP | 4.25 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.36 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|