C18H25NO2 — CID 146577471
tert-butyl N-[2,5-dimethyl-4-[(1E)-2-methylbuta-1,3-dienyl]phenyl]carbamate (PubChem CID 146577471) has the molecular formula C18H25NO2 and a molecular weight of 287.40 g/mol. Its IUPAC name is tert-butyl N-[2,5-dimethyl-4-[(1E)-2-methylbuta-1,3-dienyl]phenyl]carbamate.
| Compound Name | tert-butyl N-[2,5-dimethyl-4-[(1E)-2-methylbuta-1,3-dienyl]phenyl]carbamate |
|---|---|
| PubChem CID | 146577471 |
| Molecular Formula | C18H25NO2 |
| Molecular Weight | 287.40 g/mol |
| Exact Mass | 287.19 |
| IUPAC Name | tert-butyl N-[2,5-dimethyl-4-[(1E)-2-methylbuta-1,3-dienyl]phenyl]carbamate |
| SMILES | C=C/C(C)=C/c1cc(C)c(NC(=O)OC(C)(C)C)cc1C |
| InChI | InChI=1S/C18H25NO2/c1-8-12(2)9-15-10-14(4)16(11-13(15)3)19-17(20)21-18(5,6)7/h8-11H,1H2,2-7H3,(H,19,20)/b12-9+ |
| InChIKey | ZSGNTEGTSQNJJJ-FMIVXFBMSA-N |
| XLogP | 5.24 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.40 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|