C13H14ClFN2O — CID 146577554
[4-[(2Z,4Z)-2-chlorohepta-2,4,6-trien-3-yl]oxy-2-fluorophenyl]hydrazine (PubChem CID 146577554) has the molecular formula C13H14ClFN2O and a molecular weight of 268.72 g/mol. Its IUPAC name is [4-[(2Z,4Z)-2-chlorohepta-2,4,6-trien-3-yl]oxy-2-fluorophenyl]hydrazine.
| Compound Name | [4-[(2Z,4Z)-2-chlorohepta-2,4,6-trien-3-yl]oxy-2-fluorophenyl]hydrazine |
|---|---|
| PubChem CID | 146577554 |
| Molecular Formula | C13H14ClFN2O |
| Molecular Weight | 268.72 g/mol |
| Exact Mass | 268.08 |
| IUPAC Name | [4-[(2Z,4Z)-2-chlorohepta-2,4,6-trien-3-yl]oxy-2-fluorophenyl]hydrazine |
| SMILES | C=C/C=C\C(Oc1ccc(NN)c(F)c1)=C(/C)Cl |
| InChI | InChI=1S/C13H14ClFN2O/c1-3-4-5-13(9(2)14)18-10-6-7-12(17-16)11(15)8-10/h3-8,17H,1,16H2,2H3/b5-4-,13-9- |
| InChIKey | PPMJGJHIWIHWKZ-CVIOMZKKSA-N |
| XLogP | 3.70 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.72 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|