C15H24FN — CID 146577720
N-[(1Z,6Z)-7-fluoro-2,3,6-trimethylundeca-1,6,10-trienyl]methanimine (PubChem CID 146577720) has the molecular formula C15H24FN and a molecular weight of 237.36 g/mol. Its IUPAC name is N-[(1Z,6Z)-7-fluoro-2,3,6-trimethylundeca-1,6,10-trienyl]methanimine.
| Compound Name | N-[(1Z,6Z)-7-fluoro-2,3,6-trimethylundeca-1,6,10-trienyl]methanimine |
|---|---|
| PubChem CID | 146577720 |
| Molecular Formula | C15H24FN |
| Molecular Weight | 237.36 g/mol |
| Exact Mass | 237.19 |
| IUPAC Name | N-[(1Z,6Z)-7-fluoro-2,3,6-trimethylundeca-1,6,10-trienyl]methanimine |
| SMILES | C=CCC/C(F)=C(\C)CCC(C)/C(C)=C\N=C |
| InChI | InChI=1S/C15H24FN/c1-6-7-8-15(16)13(3)10-9-12(2)14(4)11-17-5/h6,11-12H,1,5,7-10H2,2-4H3/b14-11-,15-13- |
| InChIKey | KMDVCXZODYPLDI-AVWMJKRXSA-N |
| XLogP | 5.22 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.36 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|