C13H20FN — CID 146577737
(2E,5Z,7E)-8-fluoro-N,5,7-trimethyldeca-2,5,7,9-tetraen-2-amine (PubChem CID 146577737) has the molecular formula C13H20FN and a molecular weight of 209.31 g/mol. Its IUPAC name is (2E,5Z,7E)-8-fluoro-N,5,7-trimethyldeca-2,5,7,9-tetraen-2-amine.
| Compound Name | (2E,5Z,7E)-8-fluoro-N,5,7-trimethyldeca-2,5,7,9-tetraen-2-amine |
|---|---|
| PubChem CID | 146577737 |
| Molecular Formula | C13H20FN |
| Molecular Weight | 209.31 g/mol |
| Exact Mass | 209.16 |
| IUPAC Name | (2E,5Z,7E)-8-fluoro-N,5,7-trimethyldeca-2,5,7,9-tetraen-2-amine |
| SMILES | C=C/C(F)=C(C)\C=C(\C)C/C=C(\C)NC |
| InChI | InChI=1S/C13H20FN/c1-6-13(14)11(3)9-10(2)7-8-12(4)15-5/h6,8-9,15H,1,7H2,2-5H3/b10-9-,12-8+,13-11+ |
| InChIKey | LKJKKOFXAUMLMJ-DFQFQWLASA-N |
| XLogP | 3.88 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.31 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|