C13H16F2O — CID 146577780
2,4-difluoro-3-(4-methylpent-3-enoxy)cyclohepta-1,3,5-triene (PubChem CID 146577780) has the molecular formula C13H16F2O and a molecular weight of 226.27 g/mol. Its IUPAC name is 2,4-difluoro-3-(4-methylpent-3-enoxy)cyclohepta-1,3,5-triene.
| Compound Name | 2,4-difluoro-3-(4-methylpent-3-enoxy)cyclohepta-1,3,5-triene |
|---|---|
| PubChem CID | 146577780 |
| Molecular Formula | C13H16F2O |
| Molecular Weight | 226.27 g/mol |
| Exact Mass | 226.12 |
| IUPAC Name | 2,4-difluoro-3-(4-methylpent-3-enoxy)cyclohepta-1,3,5-triene |
| SMILES | CC(C)=CCCOC1=C(F)C=CCC=C1F |
| InChI | InChI=1S/C13H16F2O/c1-10(2)6-5-9-16-13-11(14)7-3-4-8-12(13)15/h3,6-8H,4-5,9H2,1-2H3 |
| InChIKey | ZRWBVPCIXAYTDY-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.27 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|