C36H40S — CID 146578544
4-[2-tert-butyl-3-(3,5-ditert-butylphenyl)phenyl]dibenzothiophene (PubChem CID 146578544) has the molecular formula C36H40S and a molecular weight of 504.78 g/mol. Its IUPAC name is 4-[2-tert-butyl-3-(3,5-ditert-butylphenyl)phenyl]dibenzothiophene.
| Compound Name | 4-[2-tert-butyl-3-(3,5-ditert-butylphenyl)phenyl]dibenzothiophene |
|---|---|
| PubChem CID | 146578544 |
| Molecular Formula | C36H40S |
| Molecular Weight | 504.78 g/mol |
| Exact Mass | 504.29 |
| IUPAC Name | 4-[2-tert-butyl-3-(3,5-ditert-butylphenyl)phenyl]dibenzothiophene |
| SMILES | CC(C)(C)c1cc(-c2cccc(-c3cccc4c3sc3ccccc34)c2C(C)(C)C)cc(C(C)(C)C)c1 |
| InChI | InChI=1S/C36H40S/c1-34(2,3)24-20-23(21-25(22-24)35(4,5)6)26-15-12-16-28(32(26)36(7,8)9)30-18-13-17-29-27-14-10-11-19-31(27)37-33(29)30/h10-22H,1-9H3 |
| InChIKey | IOBFTGHLMLFQMW-UHFFFAOYSA-N |
| XLogP | 11.28 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.78 |
| LogP ≤ 5 | 11.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |