C16H21FO — CID 146578763
(1Z,4Z)-8-(6-fluorocyclohepta-2,4-dien-1-yl)oxy-2-methylcycloocta-1,4-diene (PubChem CID 146578763) has the molecular formula C16H21FO and a molecular weight of 248.34 g/mol. Its IUPAC name is (1Z,4Z)-8-(6-fluorocyclohepta-2,4-dien-1-yl)oxy-2-methylcycloocta-1,4-diene.
| Compound Name | (1Z,4Z)-8-(6-fluorocyclohepta-2,4-dien-1-yl)oxy-2-methylcycloocta-1,4-diene |
|---|---|
| PubChem CID | 146578763 |
| Molecular Formula | C16H21FO |
| Molecular Weight | 248.34 g/mol |
| Exact Mass | 248.16 |
| IUPAC Name | (1Z,4Z)-8-(6-fluorocyclohepta-2,4-dien-1-yl)oxy-2-methylcycloocta-1,4-diene |
| SMILES | C/C1=C/C(OC2C=CC=CC(F)C2)CC/C=C\C1 |
| InChI | InChI=1S/C16H21FO/c1-13-7-3-2-4-9-15(11-13)18-16-10-6-5-8-14(17)12-16/h2-3,5-6,8,10-11,14-16H,4,7,9,12H2,1H3/b3-2-,13-11- |
| InChIKey | LQTYPWNCVFGOFY-JEFHYFCISA-N |
| XLogP | 4.28 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.34 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|