C15H20F3N — CID 146578951
(2E,4E)-5-ethenyl-2-methyl-6-methylidene-N-(2,2,2-trifluoroethyl)nona-2,4-dien-1-imine (PubChem CID 146578951) has the molecular formula C15H20F3N and a molecular weight of 271.33 g/mol. Its IUPAC name is (2E,4E)-5-ethenyl-2-methyl-6-methylidene-N-(2,2,2-trifluoroethyl)nona-2,4-dien-1-imine.
| Compound Name | (2E,4E)-5-ethenyl-2-methyl-6-methylidene-N-(2,2,2-trifluoroethyl)nona-2,4-dien-1-imine |
|---|---|
| PubChem CID | 146578951 |
| Molecular Formula | C15H20F3N |
| Molecular Weight | 271.33 g/mol |
| Exact Mass | 271.15 |
| IUPAC Name | (2E,4E)-5-ethenyl-2-methyl-6-methylidene-N-(2,2,2-trifluoroethyl)nona-2,4-dien-1-imine |
| SMILES | C=C/C(=C\C=C(C)\C=N\CC(F)(F)F)C(=C)CCC |
| InChI | InChI=1S/C15H20F3N/c1-5-7-13(4)14(6-2)9-8-12(3)10-19-11-15(16,17)18/h6,8-10H,2,4-5,7,11H2,1,3H3/b12-8+,14-9+,19-10+ |
| InChIKey | WSVVGGHQVIQTBT-YKZOEUOXSA-N |
| XLogP | 5.03 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.33 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|