C36H40O — CID 146579183
1-tert-butyl-2-(3,5-ditert-butylphenyl)-9-phenyldibenzofuran (PubChem CID 146579183) has the molecular formula C36H40O and a molecular weight of 488.72 g/mol. Its IUPAC name is 1-tert-butyl-2-(3,5-ditert-butylphenyl)-9-phenyldibenzofuran.
| Compound Name | 1-tert-butyl-2-(3,5-ditert-butylphenyl)-9-phenyldibenzofuran |
|---|---|
| PubChem CID | 146579183 |
| Molecular Formula | C36H40O |
| Molecular Weight | 488.72 g/mol |
| Exact Mass | 488.31 |
| IUPAC Name | 1-tert-butyl-2-(3,5-ditert-butylphenyl)-9-phenyldibenzofuran |
| SMILES | CC(C)(C)c1cc(-c2ccc3oc4cccc(-c5ccccc5)c4c3c2C(C)(C)C)cc(C(C)(C)C)c1 |
| InChI | InChI=1S/C36H40O/c1-34(2,3)25-20-24(21-26(22-25)35(4,5)6)28-18-19-30-32(33(28)36(7,8)9)31-27(16-13-17-29(31)37-30)23-14-11-10-12-15-23/h10-22H,1-9H3 |
| InChIKey | SEFPVEMJFYKDDG-UHFFFAOYSA-N |
| XLogP | 10.81 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.72 |
| LogP ≤ 5 | 10.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |