C23H35N3O2 — CID 146579237
N-[4-(methylaminomethyl)phenyl]-6-(7-oxo-6-propan-2-yl-5,6-dihydro-2H-azepin-1-yl)hexanamide (PubChem CID 146579237) has the molecular formula C23H35N3O2 and a molecular weight of 385.55 g/mol. Its IUPAC name is N-[4-(methylaminomethyl)phenyl]-6-(7-oxo-6-propan-2-yl-5,6-dihydro-2H-azepin-1-yl)hexanamide.
| Compound Name | N-[4-(methylaminomethyl)phenyl]-6-(7-oxo-6-propan-2-yl-5,6-dihydro-2H-azepin-1-yl)hexanamide |
|---|---|
| PubChem CID | 146579237 |
| Molecular Formula | C23H35N3O2 |
| Molecular Weight | 385.55 g/mol |
| Exact Mass | 385.27 |
| IUPAC Name | N-[4-(methylaminomethyl)phenyl]-6-(7-oxo-6-propan-2-yl-5,6-dihydro-2H-azepin-1-yl)hexanamide |
| SMILES | CNCc1ccc(NC(=O)CCCCCN2CC=CCC(C(C)C)C2=O)cc1 |
| InChI | InChI=1S/C23H35N3O2/c1-18(2)21-9-6-8-16-26(23(21)28)15-7-4-5-10-22(27)25-20-13-11-19(12-14-20)17-24-3/h6,8,11-14,18,21,24H,4-5,7,9-10,15-17H2,1-3H3,(H,25,27) |
| InChIKey | UNPGTKIVRULGGB-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.55 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|