C15H30N4 — CID 146579877
(2E,5Z)-6-ethyl-3-(1-methylpyrazolidin-3-yl)nona-2,5-diene-1,4-diamine (PubChem CID 146579877) has the molecular formula C15H30N4 and a molecular weight of 266.43 g/mol. Its IUPAC name is (2E,5Z)-6-ethyl-3-(1-methylpyrazolidin-3-yl)nona-2,5-diene-1,4-diamine.
| Compound Name | (2E,5Z)-6-ethyl-3-(1-methylpyrazolidin-3-yl)nona-2,5-diene-1,4-diamine |
|---|---|
| PubChem CID | 146579877 |
| Molecular Formula | C15H30N4 |
| Molecular Weight | 266.43 g/mol |
| Exact Mass | 266.25 |
| IUPAC Name | (2E,5Z)-6-ethyl-3-(1-methylpyrazolidin-3-yl)nona-2,5-diene-1,4-diamine |
| SMILES | CCC/C(=C\C(N)/C(=C\CN)C1CCN(C)N1)CC |
| InChI | InChI=1S/C15H30N4/c1-4-6-12(5-2)11-14(17)13(7-9-16)15-8-10-19(3)18-15/h7,11,14-15,18H,4-6,8-10,16-17H2,1-3H3/b12-11-,13-7+ |
| InChIKey | LGMPISJQWOVYAG-CGOMRYJBSA-N |
| XLogP | 1.54 |
| TPSA | 67.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.43 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|