C19H26F3N — CID 146579920
(2Z,4Z)-6-(4-cyclohexyl-2-methylcyclohexen-1-yl)-2,3-difluorohexa-2,4-dienimidoyl fluoride (PubChem CID 146579920) has the molecular formula C19H26F3N and a molecular weight of 325.42 g/mol. Its IUPAC name is (2Z,4Z)-6-(4-cyclohexyl-2-methylcyclohexen-1-yl)-2,3-difluorohexa-2,4-dienimidoyl fluoride.
| Compound Name | (2Z,4Z)-6-(4-cyclohexyl-2-methylcyclohexen-1-yl)-2,3-difluorohexa-2,4-dienimidoyl fluoride |
|---|---|
| PubChem CID | 146579920 |
| Molecular Formula | C19H26F3N |
| Molecular Weight | 325.42 g/mol |
| Exact Mass | 325.20 |
| IUPAC Name | (2Z,4Z)-6-(4-cyclohexyl-2-methylcyclohexen-1-yl)-2,3-difluorohexa-2,4-dienimidoyl fluoride |
| SMILES | [H]/N=C(F)/C(F)=C(F)\C=C/CC1=C(C)CC(C2CCCCC2)CC1 |
| InChI | InChI=1S/C19H26F3N/c1-13-12-16(15-6-3-2-4-7-15)11-10-14(13)8-5-9-17(20)18(21)19(22)23/h5,9,15-16,23H,2-4,6-8,10-12H2,1H3/b9-5-,18-17-,23-19- |
| InChIKey | FXGAXNHHGAIMQG-SJPQAPHOSA-N |
| XLogP | 6.73 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.42 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|