C18H26F3N3O9 — CID 146580263
[1-[2-[2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]ethylamino]-2-oxoethyl]-2,5-dioxopyrrol-3-yl] 2,2,2-trifluoroacetate (PubChem CID 146580263) has the molecular formula C18H26F3N3O9 and a molecular weight of 485.41 g/mol. Its IUPAC name is [1-[2-[2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]ethylamino]-2-oxoethyl]-2,5-dioxopyrrol-3-yl] 2,2,2-trifluoroacetate.
| Compound Name | [1-[2-[2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]ethylamino]-2-oxoethyl]-2,5-dioxopyrrol-3-yl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 146580263 |
| Molecular Formula | C18H26F3N3O9 |
| Molecular Weight | 485.41 g/mol |
| Exact Mass | 485.16 |
| IUPAC Name | [1-[2-[2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]ethylamino]-2-oxoethyl]-2,5-dioxopyrrol-3-yl] 2,2,2-trifluoroacetate |
| SMILES | NCCOCCOCCOCCOCCNC(=O)CN1C(=O)C=C(OC(=O)C(F)(F)F)C1=O |
| InChI | InChI=1S/C18H26F3N3O9/c19-18(20,21)17(28)33-13-11-15(26)24(16(13)27)12-14(25)23-2-4-30-6-8-32-10-9-31-7-5-29-3-1-22/h11H,1-10,12,22H2,(H,23,25) |
| InChIKey | JYDLXZZMNKGLHK-UHFFFAOYSA-N |
| XLogP | -1.51 |
| TPSA | 155.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.41 |
| LogP ≤ 5 | -1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|