C13H23N5O — CID 146580565
2-(5-amino-2,3,4,5-tetrahydropyridin-4-yl)-8-methyl-1,3,4,6,7,9a-hexahydropyrazino[1,2-a]pyrazin-9-one (PubChem CID 146580565) has the molecular formula C13H23N5O and a molecular weight of 265.36 g/mol. Its IUPAC name is 2-(5-amino-2,3,4,5-tetrahydropyridin-4-yl)-8-methyl-1,3,4,6,7,9a-hexahydropyrazino[1,2-a]pyrazin-9-one.
| Compound Name | 2-(5-amino-2,3,4,5-tetrahydropyridin-4-yl)-8-methyl-1,3,4,6,7,9a-hexahydropyrazino[1,2-a]pyrazin-9-one |
|---|---|
| PubChem CID | 146580565 |
| Molecular Formula | C13H23N5O |
| Molecular Weight | 265.36 g/mol |
| Exact Mass | 265.19 |
| IUPAC Name | 2-(5-amino-2,3,4,5-tetrahydropyridin-4-yl)-8-methyl-1,3,4,6,7,9a-hexahydropyrazino[1,2-a]pyrazin-9-one |
| SMILES | CN1CCN2CCN(C3CCN=CC3N)CC2C1=O |
| InChI | InChI=1S/C13H23N5O/c1-16-4-5-17-6-7-18(9-12(17)13(16)19)11-2-3-15-8-10(11)14/h8,10-12H,2-7,9,14H2,1H3 |
| InChIKey | DIJIBULHYUECLP-UHFFFAOYSA-N |
| XLogP | -1.38 |
| TPSA | 65.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.36 |
| LogP ≤ 5 | -1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |