C14H20FNO — CID 146580744
1-[(2E,4E)-4-fluoro-5-methylhepta-2,4,6-trien-2-yl]azepan-2-one (PubChem CID 146580744) has the molecular formula C14H20FNO and a molecular weight of 237.32 g/mol. Its IUPAC name is 1-[(2E,4E)-4-fluoro-5-methylhepta-2,4,6-trien-2-yl]azepan-2-one.
| Compound Name | 1-[(2E,4E)-4-fluoro-5-methylhepta-2,4,6-trien-2-yl]azepan-2-one |
|---|---|
| PubChem CID | 146580744 |
| Molecular Formula | C14H20FNO |
| Molecular Weight | 237.32 g/mol |
| Exact Mass | 237.15 |
| IUPAC Name | 1-[(2E,4E)-4-fluoro-5-methylhepta-2,4,6-trien-2-yl]azepan-2-one |
| SMILES | C=C/C(C)=C(F)\C=C(/C)N1CCCCCC1=O |
| InChI | InChI=1S/C14H20FNO/c1-4-11(2)13(15)10-12(3)16-9-7-5-6-8-14(16)17/h4,10H,1,5-9H2,2-3H3/b12-10+,13-11+ |
| InChIKey | CATQBENKSRNJQJ-DCIPZJNNSA-N |
| XLogP | 3.72 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.32 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|