C22H22ClNO5 — CID 146580816
2-chloro-6-[(2S)-2-[2-(2-formyl-3-hydroxyphenoxy)ethyl]piperidine-1-carbonyl]benzaldehyde (PubChem CID 146580816) has the molecular formula C22H22ClNO5 and a molecular weight of 415.87 g/mol. Its IUPAC name is 2-chloro-6-[(2S)-2-[2-(2-formyl-3-hydroxyphenoxy)ethyl]piperidine-1-carbonyl]benzaldehyde.
| Compound Name | 2-chloro-6-[(2S)-2-[2-(2-formyl-3-hydroxyphenoxy)ethyl]piperidine-1-carbonyl]benzaldehyde |
|---|---|
| PubChem CID | 146580816 |
| Molecular Formula | C22H22ClNO5 |
| Molecular Weight | 415.87 g/mol |
| Exact Mass | 415.12 |
| IUPAC Name | 2-chloro-6-[(2S)-2-[2-(2-formyl-3-hydroxyphenoxy)ethyl]piperidine-1-carbonyl]benzaldehyde |
| SMILES | O=Cc1c(O)cccc1OCC[C@@H]1CCCCN1C(=O)c1cccc(Cl)c1C=O |
| InChI | InChI=1S/C22H22ClNO5/c23-19-7-3-6-16(17(19)13-25)22(28)24-11-2-1-5-15(24)10-12-29-21-9-4-8-20(27)18(21)14-26/h3-4,6-9,13-15,27H,1-2,5,10-12H2/t15-/m0/s1 |
| InChIKey | MFGKLDOYMRAUMO-HNNXBMFYSA-N |
| XLogP | 4.13 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.87 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|